![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 2 Unlimited/ | 16-Feb-2006 21:39 | - | |
| 2pac/ | 16-Feb-2006 21:39 | - | |
| 3t/ | 16-Feb-2006 21:39 | - | |
| 5/ | 16-Feb-2006 21:39 | - | |
| 38 Special/ | 16-Feb-2006 21:39 | - | |
| 50 Cent/ | 16-Feb-2006 21:39 | - | |
| 98 Degrees/ | 16-Feb-2006 21:39 | - | |
| 112/ | 16-Feb-2006 21:50 | - | |
| 311/ | 16-Feb-2006 21:50 | - | |
| A-ha/ | 16-Feb-2006 21:39 | - | |
| ABC/ | 16-Feb-2006 21:39 | - | |
| ACDC/ | 16-Feb-2006 21:39 | - | |
| AFI/ | 16-Feb-2006 21:39 | - | |
| ATB/ | 16-Feb-2006 21:39 | - | |
| Aaliyah/ | 16-Feb-2006 21:39 | - | |
| Abba/ | 16-Feb-2006 21:39 | - | |
| Ace of Base/ | 16-Feb-2006 21:39 | - | |
| Aerosmith/ | 16-Feb-2006 22:40 | - | |
| Afroman/ | 16-Feb-2006 21:39 | - | |
| Air Supply/ | 16-Feb-2006 21:39 | - | |
| Alan Jackson/ | 16-Feb-2006 21:39 | - | |
| Alan Parsons Project/ | 16-Feb-2006 21:39 | - | |
| Alanis M/ | 16-Feb-2006 21:39 | - | |
| Alcazar/ | 16-Feb-2006 21:39 | - | |
| Alice Cooper/ | 16-Feb-2006 21:39 | - | |
| Alice in Chains/ | 16-Feb-2006 21:39 | - | |
| Alicia Keys/ | 16-Feb-2006 21:39 | - | |
| Alive/ | 16-Feb-2006 21:39 | - | |
| All 4 One/ | 16-Feb-2006 21:39 | - | |
| All Saints/ | 16-Feb-2006 21:39 | - | |
| Allman Brothers Band/ | 16-Feb-2006 21:39 | - | |
| Ambrosia/ | 16-Feb-2006 21:39 | - | |
| Amy Grant/ | 16-Feb-2006 21:39 | - | |
| Anastacia/ | 16-Feb-2006 21:39 | - | |
| Animals/ | 16-Feb-2006 21:39 | - | |
| Annie Lennox/ | 16-Feb-2006 21:39 | - | |
| Apollo 440/ | 16-Feb-2006 21:39 | - | |
| Aqua/ | 16-Feb-2006 21:39 | - | |
| Arrested Development/ | 16-Feb-2006 21:39 | - | |
| Ashanti/ | 16-Feb-2006 21:39 | - | |
| Asia/ | 16-Feb-2006 21:39 | - | |
| Association/ | 16-Feb-2006 21:39 | - | |
| Atlantic Star/ | 16-Feb-2006 21:39 | - | |
| Atomic Kitten/ | 16-Feb-2006 21:39 | - | |
| Average White Band/ | 16-Feb-2006 21:39 | - | |
| Avril LaVigne/ | 16-Feb-2006 21:39 | - | |
| B2K/ | 16-Feb-2006 21:39 | - | |
| B52s/ | 16-Feb-2006 21:39 | - | |
| BB Mark/ | 16-Feb-2006 21:39 | - | |
| B G/ | 16-Feb-2006 21:39 | - | |
| B Witched/ | 16-Feb-2006 21:39 | - | |
| Baby Bash/ | 16-Feb-2006 21:39 | - | |
| Babyface/ | 16-Feb-2006 21:39 | - | |
| Babylon Zoo/ | 16-Feb-2006 21:39 | - | |
| Bachman Turner Overdrive/ | 16-Feb-2006 21:39 | - | |
| Backstreet Boys/ | 16-Feb-2006 21:39 | - | |
| Bad Company/ | 16-Feb-2006 21:39 | - | |
| Bad Religion/ | 16-Feb-2006 21:39 | - | |
| Badfinger/ | 16-Feb-2006 21:39 | - | |
| Baha Men/ | 16-Feb-2006 21:39 | - | |
| Bananarama/ | 16-Feb-2006 21:39 | - | |
| Bangles/ | 16-Feb-2006 21:39 | - | |
| Barbra Streisand/ | 16-Feb-2006 21:39 | - | |
| Barry Manilow/ | 16-Feb-2006 21:39 | - | |
| Bay City Rollers/ | 16-Feb-2006 21:39 | - | |
| Beach Boys/ | 16-Feb-2006 21:39 | - | |
| Beanie Man/ | 16-Feb-2006 21:39 | - | |
| Beastie Boys/ | 16-Feb-2006 21:39 | - | |
| Beatles/ | 16-Feb-2006 21:39 | - | |
| Beautiful South/ | 16-Feb-2006 21:39 | - | |
| Beck/ | 16-Feb-2006 21:39 | - | |
| Beegees/ | 16-Feb-2006 21:39 | - | |
| Ben Folds Five/ | 16-Feb-2006 21:39 | - | |
| Berlin/ | 16-Feb-2006 21:39 | - | |
| Bette Midler/ | 16-Feb-2006 21:39 | - | |
| Biance/ | 16-Feb-2006 21:39 | - | |
| Big Bad Voodoo Daddy/ | 16-Feb-2006 21:39 | - | |
| Big Bands/ | 16-Feb-2006 21:39 | - | |
| Big Mountain/ | 16-Feb-2006 21:39 | - | |
| Big Mr/ | 16-Feb-2006 21:39 | - | |
| Big Pun/ | 16-Feb-2006 21:39 | - | |
| Big Tymers/ | 16-Feb-2006 21:39 | - | |
| Biggie/ | 16-Feb-2006 21:39 | - | |
| Bill Haley and the Comets/ | 16-Feb-2006 21:39 | - | |
| Billy Idol/ | 16-Feb-2006 21:39 | - | |
| Billy Joel/ | 16-Feb-2006 21:39 | - | |
| Billy Ocean/ | 16-Feb-2006 21:39 | - | |
| Billy Ray Cyrus/ | 16-Feb-2006 21:39 | - | |
| Biohazard/ | 16-Feb-2006 21:39 | - | |
| Bjork/ | 16-Feb-2006 21:39 | - | |
| Black Box/ | 16-Feb-2006 21:39 | - | |
| Black Sabbath/ | 16-Feb-2006 21:39 | - | |
| Blackstreet/ | 16-Feb-2006 21:39 | - | |
| Blind Melon/ | 16-Feb-2006 21:39 | - | |
| Blink 182/ | 16-Feb-2006 21:39 | - | |
| Blondie/ | 16-Feb-2006 21:39 | - | |
| Blood Sweat & Tears/ | 16-Feb-2006 21:39 | - | |
| Bloodhound Gang/ | 16-Feb-2006 21:39 | - | |
| Blue/ | 16-Feb-2006 21:39 | - | |
| Blues Brothers/ | 16-Feb-2006 21:39 | - | |
| Blues Traveller/ | 16-Feb-2006 21:39 | - | |
| Blur/ | 16-Feb-2006 21:39 | - | |
| Bob Carlislie/ | 16-Feb-2006 21:39 | - | |
| Bob Dylan/ | 16-Feb-2006 21:39 | - | |
| Bob Marley/ | 16-Feb-2006 21:39 | - | |
| Bob Seger/ | 16-Feb-2006 21:39 | - | |
| Bobby Brown/ | 16-Feb-2006 21:39 | - | |
| Bobby McFerrin/ | 16-Feb-2006 21:39 | - | |
| Bomfunk MC's/ | 16-Feb-2006 21:39 | - | |
| Bon Jovi/ | 16-Feb-2006 21:39 | - | |
| Bone/ | 16-Feb-2006 21:39 | - | |
| Bone Crusher/ | 16-Feb-2006 21:39 | - | |
| Boney M/ | 16-Feb-2006 21:39 | - | |
| Boomtown Rats/ | 16-Feb-2006 21:39 | - | |
| Boston/ | 16-Feb-2006 21:39 | - | |
| Boyz II Men/ | 16-Feb-2006 22:36 | - | |
| Boyzone/ | 16-Feb-2006 21:39 | - | |
| Brahms/ | 16-Feb-2006 21:39 | - | |
| Bran Van 3000/ | 16-Feb-2006 21:39 | - | |
| Brandy/ | 16-Feb-2006 21:39 | - | |
| Brian McKnight/ | 16-Feb-2006 21:39 | - | |
| Brian Setzer/ | 16-Feb-2006 21:39 | - | |
| Britney Spears/ | 16-Feb-2006 21:39 | - | |
| Broadway Shows/ | 16-Feb-2006 21:39 | - | |
| Brooks & Dunn/ | 16-Feb-2006 21:39 | - | |
| Bruce Hornsby/ | 16-Feb-2006 21:39 | - | |
| Bruce Springstein/ | 16-Feb-2006 21:39 | - | |
| Bryan Adams/ | 16-Feb-2006 21:39 | - | |
| Buddy Holly/ | 16-Feb-2006 21:39 | - | |
| Buggles/ | 16-Feb-2006 21:39 | - | |
| Bush/ | 16-Feb-2006 21:39 | - | |
| Busta Rhymes/ | 16-Feb-2006 21:39 | - | |
| C&C Music Factory/ | 16-Feb-2006 21:39 | - | |
| CCR/ | 16-Feb-2006 21:39 | - | |
| Cake/ | 16-Feb-2006 21:39 | - | |
| Camron/ | 16-Feb-2006 21:39 | - | |
| Captain and Tenille/ | 16-Feb-2006 21:39 | - | |
| Carl Douglas/ | 16-Feb-2006 21:39 | - | |
| Cash $ Millionaires/ | 16-Feb-2006 21:39 | - | |
| Cat Stevens/ | 16-Feb-2006 21:39 | - | |
| Celine Dion/ | 16-Feb-2006 21:39 | - | |
| Chaka Khan/ | 16-Feb-2006 21:39 | - | |
| Cheeky Girls/ | 16-Feb-2006 21:39 | - | |
| Chemical Brothers/ | 16-Feb-2006 21:39 | - | |
| Cher/ | 16-Feb-2006 21:39 | - | |
| Cherry Poppin Daddies/ | 16-Feb-2006 21:39 | - | |
| Chic/ | 16-Feb-2006 21:39 | - | |
| Chicago/ | 16-Feb-2006 21:39 | - | |
| Chicane/ | 16-Feb-2006 21:39 | - | |
| Children's Songs/ | 16-Feb-2006 21:39 | - | |
| Chingy/ | 16-Feb-2006 21:39 | - | |
| Chris Rea/ | 16-Feb-2006 21:39 | - | |
| Christian Music/ | 16-Feb-2006 21:39 | - | |
| Christina Aguilera/ | 16-Feb-2006 21:39 | - | |
| Christina Milian/ | 16-Feb-2006 21:39 | - | |
| Christmas/ | 16-Feb-2006 21:39 | - | |
| Chubby Checker/ | 16-Feb-2006 21:39 | - | |
| Chuck Berry/ | 16-Feb-2006 21:39 | - | |
| Chumbawamba/ | 16-Feb-2006 21:39 | - | |
| Clash/ | 16-Feb-2006 21:39 | - | |
| Classical/ | 16-Feb-2006 21:39 | - | |
| Cliff Richard/ | 16-Feb-2006 21:38 | - | |
| Coldplay/ | 16-Feb-2006 21:38 | - | |
| Collective Soul/ | 16-Feb-2006 21:38 | - | |
| Commodores/ | 16-Feb-2006 21:38 | - | |
| Coolio/ | 16-Feb-2006 21:38 | - | |
| Corner Shop/ | 16-Feb-2006 21:38 | - | |
| Corrs/ | 16-Feb-2006 21:38 | - | |
| Counting Crows/ | 16-Feb-2006 21:38 | - | |
| Craig David/ | 16-Feb-2006 21:38 | - | |
| Cranberries/ | 16-Feb-2006 21:38 | - | |
| Crash Test Dummies/ | 16-Feb-2006 21:38 | - | |
| Crazy Town/ | 16-Feb-2006 21:38 | - | |
| Cream/ | 16-Feb-2006 21:38 | - | |
| Creed/ | 16-Feb-2006 21:38 | - | |
| Crosby Stills & Nash/ | 16-Feb-2006 21:38 | - | |
| Crosby Stills Nash/ | 16-Feb-2006 21:38 | - | |
| Crystal Waters/ | 16-Feb-2006 21:38 | - | |
| Cyndi Lauper/ | 16-Feb-2006 21:38 | - | |
| Cypress Hill/ | 16-Feb-2006 21:38 | - | |
| D12/ | 16-Feb-2006 21:38 | - | |
| DC Talk/ | 16-Feb-2006 21:38 | - | |
| DJ Jazzy Jeff/ | 16-Feb-2006 21:38 | - | |
| DJ Sakin/ | 16-Feb-2006 21:38 | - | |
| DJ Sammy/ | 16-Feb-2006 21:38 | - | |
| D M X/ | 16-Feb-2006 21:38 | - | |
| Daft Punk/ | 16-Feb-2006 21:38 | - | |
| Dance Songs/ | 16-Feb-2006 21:38 | - | |
| Danzig/ | 16-Feb-2006 21:38 | - | |
| Darude/ | 16-Feb-2006 21:38 | - | |
| Dave Clark Five/ | 16-Feb-2006 21:38 | - | |
| Dave Matthews Band/ | 16-Feb-2006 21:38 | - | |
| David Bowie/ | 16-Feb-2006 21:38 | - | |
| David Gray/ | 16-Feb-2006 21:38 | - | |
| Debbussey/ | 16-Feb-2006 21:38 | - | |
| Deep Blue Something/ | 16-Feb-2006 21:38 | - | |
| Def Leppard/ | 16-Feb-2006 21:38 | - | |
| Deftones/ | 16-Feb-2006 21:38 | - | |
| Depeche Mode/ | 16-Feb-2006 21:38 | - | |
| Desree/ | 16-Feb-2006 21:38 | - | |
| Destiny's Child/ | 16-Feb-2006 21:38 | - | |
| Devo/ | 16-Feb-2006 21:38 | - | |
| Dido/ | 16-Feb-2006 21:38 | - | |
| Dire Straights/ | 16-Feb-2006 21:38 | - | |
| Dire Straits/ | 16-Feb-2006 21:38 | - | |
| Disney/ | 16-Feb-2006 21:38 | - | |
| Disney Songs/ | 16-Feb-2006 21:38 | - | |
| Disturbed/ | 16-Feb-2006 21:38 | - | |
| Dixys Midnight Runners/ | 16-Feb-2006 21:38 | - | |
| Dolly Parton/ | 16-Feb-2006 21:38 | - | |
| Domino Fats/ | 16-Feb-2006 21:38 | - | |
| Don Henley/ | 16-Feb-2006 21:38 | - | |
| Don McLean/ | 16-Feb-2006 21:38 | - | |
| Donna Summer/ | 16-Feb-2006 21:38 | - | |
| Doobie Brothers/ | 16-Feb-2006 21:38 | - | |
| Dr Dre/ | 16-Feb-2006 21:38 | - | |
| Dru Hill/ | 16-Feb-2006 21:38 | - | |
| Duran Duran/ | 16-Feb-2006 21:38 | - | |
| ELO/ | 16-Feb-2006 21:38 | - | |
| EMF/ | 16-Feb-2006 21:38 | - | |
| Eagles/ | 16-Feb-2006 21:38 | - | |
| Earth Wind Fire/ | 16-Feb-2006 21:38 | - | |
| Eiffel 65/ | 16-Feb-2006 21:38 | - | |
| Elton John/ | 16-Feb-2006 21:38 | - | |
| Elvis Presley/ | 16-Feb-2006 21:38 | - | |
| Emerson Lake & Palmer/ | 16-Feb-2006 21:38 | - | |
| Eminem/ | 16-Feb-2006 22:29 | - | |
| En Vogue/ | 16-Feb-2006 21:38 | - | |
| Enigma/ | 16-Feb-2006 21:38 | - | |
| Enrique Iglesias/ | 16-Feb-2006 21:38 | - | |
| Erasure/ | 16-Feb-2006 21:38 | - | |
| Eric Clapton/ | 16-Feb-2006 21:38 | - | |
| Europe/ | 16-Feb-2006 21:38 | - | |
| Eurythmics/ | 16-Feb-2006 21:38 | - | |
| Eve/ | 16-Feb-2006 21:38 | - | |
| Everclear/ | 16-Feb-2006 21:38 | - | |
| Everlast/ | 16-Feb-2006 21:38 | - | |
| Extreme/ | 16-Feb-2006 21:38 | - | |
| Fabolous/ | 16-Feb-2006 21:38 | - | |
| Faith No More/ | 16-Feb-2006 21:38 | - | |
| Falco/ | 16-Feb-2006 21:38 | - | |
| Fat Les/ | 16-Feb-2006 21:38 | - | |
| Fatboy Slim/ | 16-Feb-2006 21:38 | - | |
| Filter/ | 16-Feb-2006 21:38 | - | |
| Fleetwood Mac/ | 16-Feb-2006 21:38 | - | |
| Folk Implosion/ | 16-Feb-2006 21:38 | - | |
| Foo Fighters/ | 16-Feb-2006 21:38 | - | |
| Four Non Blondes/ | 16-Feb-2006 21:38 | - | |
| Four Seasons/ | 16-Feb-2006 21:38 | - | |
| Frank Sinatra/ | 16-Feb-2006 21:38 | - | |
| Frankie Goes To Hollywood/ | 16-Feb-2006 21:38 | - | |
| Fugees/ | 16-Feb-2006 21:38 | - | |
| Fun Lovin Criminals/ | 16-Feb-2006 21:38 | - | |
| G-Unit/ | 16-Feb-2006 21:38 | - | |
| Garbage/ | 16-Feb-2006 22:27 | - | |
| Gareth Gates/ | 16-Feb-2006 21:38 | - | |
| Garry Moore/ | 16-Feb-2006 21:38 | - | |
| Garth Brooks/ | 16-Feb-2006 21:38 | - | |
| Gary Numan/ | 16-Feb-2006 21:38 | - | |
| Genesis/ | 16-Feb-2006 21:38 | - | |
| George Benson/ | 16-Feb-2006 21:38 | - | |
| George Michael/ | 16-Feb-2006 21:38 | - | |
| Geri Halliwell/ | 16-Feb-2006 21:38 | - | |
| Gerry Rafferty/ | 16-Feb-2006 21:38 | - | |
| Gilbert O Sullivan/ | 16-Feb-2006 21:38 | - | |
| Gin Blossoms/ | 16-Feb-2006 21:38 | - | |
| Ginuwine/ | 16-Feb-2006 21:38 | - | |
| Goo Goo Dolls/ | 16-Feb-2006 21:38 | - | |
| Gorillaz/ | 16-Feb-2006 21:38 | - | |
| Gradius/ | 16-Feb-2006 21:38 | - | |
| Gravity Kills/ | 16-Feb-2006 21:38 | - | |
| Green Day/ | 16-Feb-2006 21:38 | - | |
| Guess Who/ | 16-Feb-2006 21:38 | - | |
| Guns&Roses/ | 16-Feb-2006 21:38 | - | |
| Guru Josh/ | 16-Feb-2006 21:38 | - | |
| Halloween/ | 16-Feb-2006 21:38 | - | |
| Hanson/ | 16-Feb-2006 21:38 | - | |
| Harry Chapin/ | 16-Feb-2006 21:38 | - | |
| Harry Nilsson/ | 16-Feb-2006 21:38 | - | |
| Harvey Danger/ | 16-Feb-2006 21:38 | - | |
| Heart/ | 16-Feb-2006 21:38 | - | |
| Herbie Hancock/ | 16-Feb-2006 21:38 | - | |
| Hole/ | 16-Feb-2006 21:38 | - | |
| Hootie&Blowfish/ | 16-Feb-2006 21:38 | - | |
| Hot Chocolate/ | 16-Feb-2006 21:38 | - | |
| Human League/ | 16-Feb-2006 21:38 | - | |
| Ian Dury/ | 16-Feb-2006 21:38 | - | |
| Imperial Teen/ | 16-Feb-2006 21:38 | - | |
| Insomnia/ | 16-Feb-2006 21:38 | - | |
| Inxs/ | 16-Feb-2006 21:38 | - | |
| Iron Butterfly/ | 16-Feb-2006 21:38 | - | |
| Iron Maiden/ | 16-Feb-2006 21:38 | - | |
| J-Kwon/ | 16-Feb-2006 21:38 | - | |
| JLo/ | 16-Feb-2006 21:38 | - | |
| Ja Rule/ | 16-Feb-2006 21:38 | - | |
| Jackson Five/ | 16-Feb-2006 21:38 | - | |
| Jagged Edge/ | 16-Feb-2006 21:38 | - | |
| James Brown/ | 16-Feb-2006 21:38 | - | |
| Jamiroquai/ | 16-Feb-2006 21:38 | - | |
| Jane's Addiction/ | 16-Feb-2006 21:38 | - | |
| Janet Jackson/ | 16-Feb-2006 21:38 | - | |
| Jay-Z/ | 16-Feb-2006 21:38 | - | |
| Jazz/ | 16-Feb-2006 21:38 | - | |
| Jethro Tull/ | 16-Feb-2006 21:38 | - | |
| Jewel/ | 16-Feb-2006 21:38 | - | |
| Jimi Hendrix/ | 16-Feb-2006 21:38 | - | |
| Jimmy Buffet/ | 16-Feb-2006 21:38 | - | |
| Joan Osbourne/ | 16-Feb-2006 21:38 | - | |
| Joe Cocker/ | 16-Feb-2006 21:38 | - | |
| John Lennon/ | 16-Feb-2006 21:38 | - | |
| Johnny Cash/ | 16-Feb-2006 21:38 | - | |
| Johnny Nash/ | 16-Feb-2006 21:38 | - | |
| Joni Mitchell/ | 16-Feb-2006 21:38 | - | |
| Journey/ | 16-Feb-2006 21:38 | - | |
| Justin Timberlake/ | 16-Feb-2006 21:38 | - | |
| K-Ci & Jojo/ | 16-Feb-2006 21:38 | - | |
| K7/ | 16-Feb-2006 21:38 | - | |
| KC&Sunshine Band/ | 16-Feb-2006 21:38 | - | |
| Kansas/ | 16-Feb-2006 21:38 | - | |
| Kate Bush/ | 16-Feb-2006 21:38 | - | |
| Kayne West/ | 16-Feb-2006 21:38 | - | |
| Kelis/ | 16-Feb-2006 21:38 | - | |
| Kenji Tanaka/ | 16-Feb-2006 21:38 | - | |
| Kenny G/ | 16-Feb-2006 21:38 | - | |
| Kenny Rogers/ | 16-Feb-2006 21:38 | - | |
| Kid Rock/ | 16-Feb-2006 21:38 | - | |
| Kim Carnes/ | 16-Feb-2006 21:38 | - | |
| Kinks/ | 16-Feb-2006 21:38 | - | |
| Kiss/ | 16-Feb-2006 21:38 | - | |
| Korn/ | 16-Feb-2006 21:38 | - | |
| Kraftwerk/ | 16-Feb-2006 21:38 | - | |
| Kylie Minogue/ | 16-Feb-2006 21:38 | - | |
| LIVE/ | 16-Feb-2006 21:38 | - | |
| La Bouche/ | 16-Feb-2006 21:38 | - | |
| Lauren Hill/ | 16-Feb-2006 21:38 | - | |
| Leann Rimes/ | 16-Feb-2006 21:38 | - | |
| Led Zeppelin/ | 16-Feb-2006 21:38 | - | |
| Lenny Kravitz/ | 16-Feb-2006 21:38 | - | |
| Level 42/ | 16-Feb-2006 21:38 | - | |
| Lewis Huey&News/ | 16-Feb-2006 21:38 | - | |
| Liberty X/ | 16-Feb-2006 21:38 | - | |
| Lightning Seeds/ | 16-Feb-2006 21:38 | - | |
| Lil Jon/ | 16-Feb-2006 21:38 | - | |
| Lil Kim/ | 16-Feb-2006 21:38 | - | |
| Limp Bizkit/ | 16-Feb-2006 21:38 | - | |
| Linkin Park/ | 16-Feb-2006 21:38 | - | |
| Lionel Richie/ | 16-Feb-2006 21:38 | - | |
| Lisa Loeb/ | 16-Feb-2006 21:38 | - | |
| Lit/ | 16-Feb-2006 21:38 | - | |
| Lloyd Banks/ | 16-Feb-2006 21:38 | - | |
| Local H/ | 16-Feb-2006 21:38 | - | |
| Lonestar/ | 16-Feb-2006 21:38 | - | |
| Loon/ | 16-Feb-2006 21:38 | - | |
| Los Del Rios/ | 16-Feb-2006 21:38 | - | |
| Louis Armstrong/ | 16-Feb-2006 21:38 | - | |
| Ludacris/ | 16-Feb-2006 21:38 | - | |
| Lumidee/ | 16-Feb-2006 21:38 | - | |
| Luniz/ | 16-Feb-2006 21:38 | - | |
| Lynnard Skynard/ | 16-Feb-2006 21:38 | - | |
| M2M/ | 16-Feb-2006 21:38 | - | |
| MC Hammer/ | 16-Feb-2006 21:38 | - | |
| M People/ | 16-Feb-2006 21:38 | - | |
| Macy Gray/ | 16-Feb-2006 21:38 | - | |
| Madness/ | 16-Feb-2006 21:38 | - | |
| Madonna/ | 16-Feb-2006 21:38 | - | |
| Mamas&Papas/ | 16-Feb-2006 21:38 | - | |
| Manfred Man/ | 16-Feb-2006 21:38 | - | |
| Manhatten Transfer/ | 16-Feb-2006 21:38 | - | |
| Manic Street Preachers/ | 16-Feb-2006 21:38 | - | |
| Marc Anthony/ | 16-Feb-2006 21:38 | - | |
| Mariah Carrey/ | 16-Feb-2006 22:19 | - | |
| Marillion/ | 16-Feb-2006 21:38 | - | |
| Marilyn Manson/ | 16-Feb-2006 21:38 | - | |
| Mark Morrison/ | 16-Feb-2006 21:38 | - | |
| Marky Mark/ | 16-Feb-2006 21:38 | - | |
| Marty Keil/ | 16-Feb-2006 21:38 | - | |
| Marvin Gaye/ | 16-Feb-2006 21:38 | - | |
| Mary J. Blige/ | 16-Feb-2006 21:38 | - | |
| Matchbox 20/ | 16-Feb-2006 21:38 | - | |
| Mauro Picotto/ | 16-Feb-2006 21:38 | - | |
| Maxwell/ | 16-Feb-2006 21:38 | - | |
| Maxx/ | 16-Feb-2006 21:38 | - | |
| Meat Puppets/ | 16-Feb-2006 21:38 | - | |
| Meatloaf/ | 16-Feb-2006 21:38 | - | |
| Megadeth/ | 16-Feb-2006 21:38 | - | |
| Mel C/ | 16-Feb-2006 21:38 | - | |
| Melanie/ | 16-Feb-2006 21:38 | - | |
| Melissa Manchester/ | 16-Feb-2006 21:38 | - | |
| Mellancamp John Cougar/ | 16-Feb-2006 21:38 | - | |
| Men Without Hats/ | 16-Feb-2006 21:38 | - | |
| Men at Work/ | 16-Feb-2006 21:38 | - | |
| Meridith Brooks/ | 16-Feb-2006 21:38 | - | |
| Metallica/ | 16-Feb-2006 21:38 | - | |
| Miami Sound Machine/ | 16-Feb-2006 21:38 | - | |
| Michael Bolton/ | 16-Feb-2006 21:38 | - | |
| Michael Jackson/ | 16-Feb-2006 22:18 | - | |
| Midnight Oil/ | 16-Feb-2006 21:38 | - | |
| Mighty Mighty Bosstones/ | 16-Feb-2006 21:38 | - | |
| Mike&Mechanics/ | 16-Feb-2006 21:38 | - | |
| Mike Oldfield/ | 16-Feb-2006 21:38 | - | |
| Misfits/ | 16-Feb-2006 21:38 | - | |
| Missy Elliot/ | 16-Feb-2006 21:38 | - | |
| Moby/ | 16-Feb-2006 21:38 | - | |
| Modjo/ | 16-Feb-2006 21:38 | - | |
| Moist/ | 16-Feb-2006 21:38 | - | |
| Monica/ | 16-Feb-2006 21:38 | - | |
| Monkees/ | 16-Feb-2006 21:38 | - | |
| Motley Crew/ | 16-Feb-2006 21:38 | - | |
| Movie Themes/ | 16-Feb-2006 21:38 | - | |
| Mya/ | 16-Feb-2006 21:38 | - | |
| N.E.R.D/ | 16-Feb-2006 21:38 | - | |
| N.O.R.E/ | 16-Feb-2006 21:38 | - | |
| N Sync/ | 16-Feb-2006 22:15 | - | |
| Nada Surf/ | 16-Feb-2006 21:38 | - | |
| Nas/ | 16-Feb-2006 21:38 | - | |
| Natalie Imbruglia/ | 16-Feb-2006 21:38 | - | |
| Natalie Merchant/ | 16-Feb-2006 21:38 | - | |
| National Anthems/ | 16-Feb-2006 21:38 | - | |
| Nazereth/ | 16-Feb-2006 21:38 | - | |
| Neil Diamond/ | 16-Feb-2006 21:38 | - | |
| Nelly/ | 16-Feb-2006 22:17 | - | |
| New Order/ | 16-Feb-2006 21:38 | - | |
| New Seekers/ | 16-Feb-2006 21:38 | - | |
| Nickelback/ | 16-Feb-2006 21:38 | - | |
| Nina/ | 16-Feb-2006 21:38 | - | |
| Nine Inch Nails/ | 16-Feb-2006 22:16 | - | |
| Nirvana/ | 16-Feb-2006 22:16 | - | |
| No Doubt/ | 16-Feb-2006 21:38 | - | |
| NoFX/ | 16-Feb-2006 21:38 | - | |
| Notorious Big/ | 16-Feb-2006 21:38 | - | |
| OEM Ringers/ | 16-Feb-2006 21:38 | - | |
| O Jays/ | 16-Feb-2006 21:38 | - | |
| Oasis/ | 16-Feb-2006 21:38 | - | |
| Ocean Colour Scene/ | 16-Feb-2006 21:38 | - | |
| Offspring/ | 16-Feb-2006 21:38 | - | |
| Olivia Newton John/ | 16-Feb-2006 21:38 | - | |
| Omd/ | 16-Feb-2006 21:38 | - | |
| Outhere Brothers/ | 16-Feb-2006 21:38 | - | |
| Outkast/ | 16-Feb-2006 21:38 | - | |
| Ozzy/ | 16-Feb-2006 21:38 | - | |
| Pachelbel/ | 16-Feb-2006 21:38 | - | |
| Pantera/ | 16-Feb-2006 21:38 | - | |
| Papa Roach/ | 16-Feb-2006 21:38 | - | |
| Partridge Family/ | 16-Feb-2006 21:38 | - | |
| Pat Benatar/ | 16-Feb-2006 21:38 | - | |
| Patriotic Songs/ | 16-Feb-2006 21:38 | - | |
| Paul Young/ | 16-Feb-2006 21:38 | - | |
| Paula Abdul/ | 16-Feb-2006 22:13 | - | |
| Paula Cole/ | 16-Feb-2006 21:38 | - | |
| P diddy/ | 16-Feb-2006 21:38 | - | |
| Pearl Jam/ | 16-Feb-2006 21:38 | - | |
| Pennywise/ | 16-Feb-2006 21:38 | - | |
| Pet Shop Boys/ | 16-Feb-2006 21:38 | - | |
| Peter Cetera/ | 16-Feb-2006 21:38 | - | |
| Peter Gabriele/ | 16-Feb-2006 21:38 | - | |
| Peter Paul&Mary/ | 16-Feb-2006 21:38 | - | |
| Petula Clarke/ | 16-Feb-2006 21:38 | - | |
| Phil Collins/ | 16-Feb-2006 21:38 | - | |
| Phish/ | 16-Feb-2006 21:38 | - | |
| Pietasters/ | 16-Feb-2006 21:38 | - | |
| Pink/ | 16-Feb-2006 21:38 | - | |
| Pink Floyd/ | 16-Feb-2006 21:38 | - | |
| Platters/ | 16-Feb-2006 21:38 | - | |
| Police/ | 16-Feb-2006 21:38 | - | |
| Poly/ | 16-Feb-2006 21:38 | - | |
| Presidents of USA/ | 16-Feb-2006 21:38 | - | |
| Primus/ | 16-Feb-2006 21:38 | - | |
| Prince/ | 16-Feb-2006 21:38 | - | |
| Prodigy/ | 16-Feb-2006 21:38 | - | |
| Quad City DJs/ | 16-Feb-2006 21:38 | - | |
| Queen/ | 16-Feb-2006 21:38 | - | |
| R E M/ | 16-Feb-2006 21:38 | - | |
| R Kelly/ | 16-Feb-2006 22:11 | - | |
| Radiohead/ | 16-Feb-2006 21:38 | - | |
| Rage Against the Machine/ | 16-Feb-2006 21:38 | - | |
| Ram Jam/ | 16-Feb-2006 21:38 | - | |
| Rammstein/ | 16-Feb-2006 21:38 | - | |
| Ramones/ | 16-Feb-2006 21:38 | - | |
| Rancid/ | 16-Feb-2006 21:38 | - | |
| Ray Charles/ | 16-Feb-2006 21:38 | - | |
| Rea Chris/ | 16-Feb-2006 21:38 | - | |
| Real McCoy/ | 16-Feb-2006 21:38 | - | |
| Red Hot Chili Peppers/ | 16-Feb-2006 21:38 | - | |
| Rednex/ | 16-Feb-2006 21:38 | - | |
| Reel 2 Reel/ | 16-Feb-2006 21:38 | - | |
| Reel Big Fish/ | 16-Feb-2006 21:38 | - | |
| Reo Speedwagon/ | 16-Feb-2006 21:38 | - | |
| Richard Marx/ | 16-Feb-2006 21:38 | - | |
| Ricky Martin/ | 16-Feb-2006 21:38 | - | |
| Right Said Fred/ | 16-Feb-2006 21:38 | - | |
| Righteous Brothers/ | 16-Feb-2006 21:38 | - | |
| Rob Zombie/ | 16-Feb-2006 21:38 | - | |
| Robbie Williams/ | 16-Feb-2006 21:38 | - | |
| Robert Miles/ | 16-Feb-2006 21:38 | - | |
| Robert Palmer/ | 16-Feb-2006 21:38 | - | |
| Roberta Flack/ | 16-Feb-2006 21:38 | - | |
| Rod Stewart/ | 16-Feb-2006 21:38 | - | |
| Rolling Stones/ | 16-Feb-2006 21:38 | - | |
| Ronan Keating/ | 16-Feb-2006 21:38 | - | |
| Roxette/ | 16-Feb-2006 21:38 | - | |
| Roy Orbison/ | 16-Feb-2006 21:38 | - | |
| Run DMC/ | 16-Feb-2006 21:38 | - | |
| Rush/ | 16-Feb-2006 21:38 | - | |
| S.O.A.D/ | 16-Feb-2006 21:38 | - | |
| S Club 7/ | 16-Feb-2006 21:38 | - | |
| S T P/ | 16-Feb-2006 21:38 | - | |
| Sailor Moon/ | 16-Feb-2006 21:38 | - | |
| Sarah Mclachlan/ | 16-Feb-2006 21:38 | - | |
| Sash/ | 16-Feb-2006 21:38 | - | |
| Savage Garden/ | 16-Feb-2006 21:38 | - | |
| Scooter/ | 16-Feb-2006 21:38 | - | |
| Seal/ | 16-Feb-2006 21:38 | - | |
| Sean Paul/ | 16-Feb-2006 21:38 | - | |
| Selena/ | 16-Feb-2006 21:38 | - | |
| Semisonic/ | 16-Feb-2006 21:38 | - | |
| Sex Pistols/ | 16-Feb-2006 21:38 | - | |
| Shaggy/ | 16-Feb-2006 21:38 | - | |
| Shakira/ | 16-Feb-2006 21:38 | - | |
| Shamen/ | 16-Feb-2006 21:38 | - | |
| Shania Twain/ | 16-Feb-2006 22:08 | - | |
| Shannon Del/ | 16-Feb-2006 21:38 | - | |
| Shawn Colven/ | 16-Feb-2006 21:38 | - | |
| Sheryl Crow/ | 16-Feb-2006 21:38 | - | |
| Silverchair/ | 16-Feb-2006 21:38 | - | |
| Simon&Garfunkel/ | 16-Feb-2006 21:38 | - | |
| Simple Minds/ | 16-Feb-2006 21:38 | - | |
| Simply Red/ | 16-Feb-2006 21:38 | - | |
| Sinead O Connor/ | 16-Feb-2006 21:38 | - | |
| Sisqo/ | 16-Feb-2006 21:38 | - | |
| Sixpence None the Richer/ | 16-Feb-2006 21:38 | - | |
| Skankin'Pickle/ | 16-Feb-2006 21:38 | - | |
| Skee Lo/ | 16-Feb-2006 21:38 | - | |
| Slade/ | 16-Feb-2006 21:38 | - | |
| Smash Mouth/ | 16-Feb-2006 21:38 | - | |
| Smashing Pumpkins/ | 16-Feb-2006 21:38 | - | |
| Snap/ | 16-Feb-2006 21:38 | - | |
| Snoop Dogg/ | 16-Feb-2006 21:38 | - | |
| Sonique/ | 16-Feb-2006 21:38 | - | |
| Sophie Hawkins/ | 16-Feb-2006 21:38 | - | |
| Soul Asylum/ | 16-Feb-2006 21:38 | - | |
| Sound Garden/ | 16-Feb-2006 21:38 | - | |
| Specials/ | 16-Feb-2006 21:38 | - | |
| Spice Girls/ | 16-Feb-2006 22:06 | - | |
| Spin Doctors/ | 16-Feb-2006 21:38 | - | |
| Sports/ | 16-Feb-2006 21:38 | - | |
| Stereophonics/ | 16-Feb-2006 21:38 | - | |
| Steve Miller Band/ | 16-Feb-2006 21:38 | - | |
| Stevie Nicks/ | 16-Feb-2006 21:38 | - | |
| Stevie Wonder/ | 16-Feb-2006 21:38 | - | |
| Sting/ | 16-Feb-2006 21:38 | - | |
| Stone Roses/ | 16-Feb-2006 21:38 | - | |
| Stone Temple Pilots/ | 16-Feb-2006 21:38 | - | |
| Stranglers/ | 16-Feb-2006 21:38 | - | |
| Stylistics/ | 16-Feb-2006 21:38 | - | |
| Styx/ | 16-Feb-2006 22:03 | - | |
| Sublime/ | 16-Feb-2006 21:38 | - | |
| Sugar Ray/ | 16-Feb-2006 21:38 | - | |
| Sugarbabes/ | 16-Feb-2006 21:38 | - | |
| Sum 41/ | 16-Feb-2006 21:38 | - | |
| Super Tramp/ | 16-Feb-2006 21:38 | - | |
| Supertones/ | 16-Feb-2006 21:38 | - | |
| System F/ | 16-Feb-2006 21:38 | - | |
| T L C/ | 16-Feb-2006 21:38 | - | |
| TLC/ | 16-Feb-2006 21:38 | - | |
| T Rex/ | 16-Feb-2006 21:38 | - | |
| TV Themes/ | 16-Feb-2006 21:38 | - | |
| Tag Team/ | 16-Feb-2006 21:38 | - | |
| Talk Talk/ | 16-Feb-2006 21:38 | - | |
| Talking Heads/ | 16-Feb-2006 21:38 | - | |
| Tasmin Archer/ | 16-Feb-2006 21:38 | - | |
| Tatu/ | 16-Feb-2006 21:38 | - | |
| Tears for Fears/ | 16-Feb-2006 21:38 | - | |
| Technotronic/ | 16-Feb-2006 21:38 | - | |
| Temptations/ | 16-Feb-2006 21:38 | - | |
| Terence Trent/ | 16-Feb-2006 21:38 | - | |
| The Byrds/ | 16-Feb-2006 21:38 | - | |
| The Carpenters/ | 16-Feb-2006 21:38 | - | |
| The Cars/ | 16-Feb-2006 21:38 | - | |
| The Cult/ | 16-Feb-2006 21:38 | - | |
| The Cure/ | 16-Feb-2006 21:38 | - | |
| The Doors/ | 16-Feb-2006 21:38 | - | |
| The Drifters/ | 16-Feb-2006 21:38 | - | |
| The English Beat/ | 16-Feb-2006 21:38 | - | |
| The Hooters/ | 16-Feb-2006 21:38 | - | |
| The Monkeys/ | 16-Feb-2006 21:38 | - | |
| The Moody Blues/ | 16-Feb-2006 21:38 | - | |
| The Pretenders/ | 16-Feb-2006 21:38 | - | |
| The Proclaimers/ | 16-Feb-2006 21:38 | - | |
| The Smiths/ | 16-Feb-2006 21:38 | - | |
| The Ventures/ | 16-Feb-2006 21:38 | - | |
| The Verve/ | 16-Feb-2006 21:38 | - | |
| The Who/ | 16-Feb-2006 21:38 | - | |
| They Might Be Giants/ | 16-Feb-2006 21:38 | - | |
| Third Eye Blind/ | 16-Feb-2006 21:38 | - | |
| Thomas Dolby/ | 16-Feb-2006 21:38 | - | |
| Thomson Twins/ | 16-Feb-2006 21:38 | - | |
| Tiffany/ | 16-Feb-2006 21:38 | - | |
| Tina Turner/ | 16-Feb-2006 21:38 | - | |
| Toad the Wet Sprocket/ | 16-Feb-2006 21:38 | - | |
| Tokens/ | 16-Feb-2006 21:38 | - | |
| Tom Green/ | 16-Feb-2006 21:38 | - | |
| Tom Petty/ | 16-Feb-2006 21:38 | - | |
| Toni Braxton/ | 16-Feb-2006 22:00 | - | |
| Tool/ | 16-Feb-2006 21:38 | - | |
| Top Loader/ | 16-Feb-2006 21:38 | - | |
| Tori Amos/ | 16-Feb-2006 21:38 | - | |
| Toto/ | 16-Feb-2006 21:38 | - | |
| Traci Chapman/ | 16-Feb-2006 21:38 | - | |
| Trance/ | 16-Feb-2006 21:38 | - | |
| Traveling Wilburys/ | 16-Feb-2006 21:38 | - | |
| Travis/ | 16-Feb-2006 21:38 | - | |
| Troggs/ | 16-Feb-2006 21:38 | - | |
| Twista/ | 16-Feb-2006 21:38 | - | |
| Type O Negative/ | 16-Feb-2006 21:38 | - | |
| U2/ | 16-Feb-2006 21:38 | - | |
| U96/ | 16-Feb-2006 21:38 | - | |
| UB40/ | 16-Feb-2006 21:38 | - | |
| Ugly Kid Joe/ | 16-Feb-2006 21:38 | - | |
| Us3/ | 16-Feb-2006 21:38 | - | |
| Usher/ | 16-Feb-2006 21:52 | - | |
| Van Halen/ | 16-Feb-2006 21:38 | - | |
| Van Morrison/ | 16-Feb-2006 21:38 | - | |
| Vandals/ | 16-Feb-2006 21:38 | - | |
| Vangelis/ | 16-Feb-2006 21:38 | - | |
| Venga Boys/ | 16-Feb-2006 21:38 | - | |
| Vertical Horizon/ | 16-Feb-2006 21:38 | - | |
| Veruca Salt/ | 16-Feb-2006 21:38 | - | |
| Verve Pipe/ | 16-Feb-2006 21:38 | - | |
| Video Games/ | 16-Feb-2006 21:38 | - | |
| Village People/ | 16-Feb-2006 21:38 | - | |
| Wall Flowers/ | 16-Feb-2006 21:38 | - | |
| War/ | 16-Feb-2006 21:38 | - | |
| Warren G/ | 16-Feb-2006 21:38 | - | |
| Warren Zevon/ | 16-Feb-2006 21:38 | - | |
| Weather Report/ | 16-Feb-2006 21:38 | - | |
| Weezer/ | 16-Feb-2006 21:38 | - | |
| West Life/ | 16-Feb-2006 21:38 | - | |
| Wheatus/ | 16-Feb-2006 21:38 | - | |
| Whigfield/ | 16-Feb-2006 21:38 | - | |
| White Snake/ | 16-Feb-2006 21:38 | - | |
| White Zombie/ | 16-Feb-2006 21:38 | - | |
| Whitetown/ | 16-Feb-2006 21:38 | - | |
| Whitney Houston/ | 16-Feb-2006 21:38 | - | |
| Wierd Al Yankovic/ | 16-Feb-2006 21:38 | - | |
| Will Smith/ | 16-Feb-2006 21:38 | - | |
| William Orbit/ | 16-Feb-2006 21:38 | - | |
| Wu Tang/ | 16-Feb-2006 21:38 | - | |
| Xzibit/ | 16-Feb-2006 21:38 | - | |
| Yes/ | 16-Feb-2006 21:38 | - | |
| Ying Yang Twins/ | 16-Feb-2006 21:38 | - | |
| ZZ Top/ | 16-Feb-2006 21:38 | - | |
| beatles2/ | 15-Oct-2004 23:56 | - | |